C28H31NO6 — CID 11294517
(3R,4S)-3-[3-hydroxy-3-[4-(methoxymethoxy)phenyl]propyl]-1,4-bis(4-methoxyphenyl)azetidin-2-one (PubChem CID 11294517) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (3R,4S)-3-[3-hydroxy-3-[4-(methoxymethoxy)phenyl]propyl]-1,4-bis(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-[3-hydroxy-3-[4-(methoxymethoxy)phenyl]propyl]-1,4-bis(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11294517 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (3R,4S)-3-[3-hydroxy-3-[4-(methoxymethoxy)phenyl]propyl]-1,4-bis(4-methoxyphenyl)azetidin-2-one |
| SMILES | COCOc1ccc(C(O)CC[C@H]2C(=O)N(c3ccc(OC)cc3)[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H31NO6/c1-32-18-35-24-12-4-19(5-13-24)26(30)17-16-25-27(20-6-10-22(33-2)11-7-20)29(28(25)31)21-8-14-23(34-3)15-9-21/h4-15,25-27,30H,16-18H2,1-3H3/t25-,26?,27-/m1/s1 |
| InChIKey | JROINEXKTJZVST-HMJWCELSSA-N |
| XLogP | 4.90 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|