C24H26FN5O3S — CID 11294662
ethyl 4-[4-(2-acetamido-4-pyridinyl)-5-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-3-yl]piperidine-1-carboxylate (PubChem CID 11294662) has the molecular formula C24H26FN5O3S and a molecular weight of 483.57 g/mol. Its IUPAC name is ethyl 4-[4-(2-acetamido-4-pyridinyl)-5-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-3-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(2-acetamido-4-pyridinyl)-5-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11294662 |
| Molecular Formula | C24H26FN5O3S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 4-[4-(2-acetamido-4-pyridinyl)-5-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-3-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(n2c(-c3ccnc(NC(C)=O)c3)c(-c3ccc(F)cc3)[nH]c2=S)CC1 |
| InChI | InChI=1S/C24H26FN5O3S/c1-3-33-24(32)29-12-9-19(10-13-29)30-22(17-8-11-26-20(14-17)27-15(2)31)21(28-23(30)34)16-4-6-18(25)7-5-16/h4-8,11,14,19H,3,9-10,12-13H2,1-2H3,(H,28,34)(H,26,27,31) |
| InChIKey | RJKUCHQANYNBIQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|