C19H19FN4OS2 — CID 11373031
N-[4-[5-(4-fluorophenyl)-3-(2-methylsulfanylethyl)-2-sulfanylidene-1H-imidazol-4-yl]-2-pyridinyl]acetamide (PubChem CID 11373031) has the molecular formula C19H19FN4OS2 and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[4-[5-(4-fluorophenyl)-3-(2-methylsulfanylethyl)-2-sulfanylidene-1H-imidazol-4-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[5-(4-fluorophenyl)-3-(2-methylsulfanylethyl)-2-sulfanylidene-1H-imidazol-4-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 11373031 |
| Molecular Formula | C19H19FN4OS2 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[4-[5-(4-fluorophenyl)-3-(2-methylsulfanylethyl)-2-sulfanylidene-1H-imidazol-4-yl]-2-pyridinyl]acetamide |
| SMILES | CSCCn1c(-c2ccnc(NC(C)=O)c2)c(-c2ccc(F)cc2)[nH]c1=S |
| InChI | InChI=1S/C19H19FN4OS2/c1-12(25)22-16-11-14(7-8-21-16)18-17(13-3-5-15(20)6-4-13)23-19(26)24(18)9-10-27-2/h3-8,11H,9-10H2,1-2H3,(H,23,26)(H,21,22,25) |
| InChIKey | VWKYFTRJWQANBU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|