C20H23N5O — CID 112947401
5-(4-benzylpiperidin-1-yl)-N-(furan-2-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 112947401) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)-N-(furan-2-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-benzylpiperidin-1-yl)-N-(furan-2-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112947401 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)-N-(furan-2-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | c1ccc(CC2CCN(c3cnnc(NCc4ccco4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-2-5-16(6-3-1)13-17-8-10-25(11-9-17)19-15-22-24-20(23-19)21-14-18-7-4-12-26-18/h1-7,12,15,17H,8-11,13-14H2,(H,21,23,24) |
| InChIKey | OTUBENCSAMKXFJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |