C23H32BrNO6 — CID 11294952
ditert-butyl (2R,5R)-5-[(1S)-1-(4-bromophenyl)-2-methoxy-2-oxoethyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 11294952) has the molecular formula C23H32BrNO6 and a molecular weight of 498.41 g/mol. Its IUPAC name is ditert-butyl (2R,5R)-5-[(1S)-1-(4-bromophenyl)-2-methoxy-2-oxoethyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,5R)-5-[(1S)-1-(4-bromophenyl)-2-methoxy-2-oxoethyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11294952 |
| Molecular Formula | C23H32BrNO6 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | ditert-butyl (2R,5R)-5-[(1S)-1-(4-bromophenyl)-2-methoxy-2-oxoethyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H](c1ccc(Br)cc1)[C@H]1CC[C@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32BrNO6/c1-22(2,3)30-19(26)17-13-12-16(25(17)21(28)31-23(4,5)6)18(20(27)29-7)14-8-10-15(24)11-9-14/h8-11,16-18H,12-13H2,1-7H3/t16-,17-,18+/m1/s1 |
| InChIKey | CEDPWNNSJBRVMV-KURKYZTESA-N |
| XLogP | 4.82 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|