C22H28BrNO5 — CID 90396714
2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate (PubChem CID 90396714) has the molecular formula C22H28BrNO5 and a molecular weight of 466.37 g/mol. Its IUPAC name is 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90396714 |
| Molecular Formula | C22H28BrNO5 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCCC2C[C@H]1C(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H28BrNO5/c1-22(2,3)29-21(27)24-17-7-5-4-6-15(17)12-18(24)20(26)28-13-19(25)14-8-10-16(23)11-9-14/h8-11,15,17-18H,4-7,12-13H2,1-3H3/t15?,17?,18-/m0/s1 |
| InChIKey | QSJMDVFXVKBSLY-VJFUWPCTSA-N |
| XLogP | 4.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |