C20H28BrN3O3 — CID 86674082
tert-butyl (2S,3aS,7aS)-2-[(2-amino-4-bromophenyl)carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 86674082) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is tert-butyl (2S,3aS,7aS)-2-[(2-amino-4-bromophenyl)carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,7aS)-2-[(2-amino-4-bromophenyl)carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 86674082 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | tert-butyl (2S,3aS,7aS)-2-[(2-amino-4-bromophenyl)carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(=O)Nc2ccc(Br)cc2N)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H28BrN3O3/c1-20(2,3)27-19(26)24-16-7-5-4-6-12(16)10-17(24)18(25)23-15-9-8-13(21)11-14(15)22/h8-9,11-12,16-17H,4-7,10,22H2,1-3H3,(H,23,25)/t12-,16-,17-/m0/s1 |
| InChIKey | AGAMRMHTEMMIQU-ZLIFDBKOSA-N |
| XLogP | 4.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|