C24H34N2O3 — CID 59415460
tert-butyl (2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 59415460) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 59415460 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | tert-butyl (2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCCC2C[C@H]1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C24H34N2O3/c1-24(2,3)29-23(28)26-20-14-7-5-10-17(20)15-21(26)22(27)25-19-13-8-11-16-9-4-6-12-18(16)19/h4,6,9,12,17,19-21H,5,7-8,10-11,13-15H2,1-3H3,(H,25,27)/t17?,19-,20?,21+/m1/s1 |
| InChIKey | ZAPFUHOHQXYPAO-WDQDQHCCSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |