C22H32N2O3 — CID 175247573
tert-butyl (2S,3aS,7aS)-2-(2-phenylethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 175247573) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl (2S,3aS,7aS)-2-(2-phenylethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,7aS)-2-(2-phenylethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 175247573 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl (2S,3aS,7aS)-2-(2-phenylethylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(=O)NCCc2ccccc2)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H32N2O3/c1-22(2,3)27-21(26)24-18-12-8-7-11-17(18)15-19(24)20(25)23-14-13-16-9-5-4-6-10-16/h4-6,9-10,17-19H,7-8,11-15H2,1-3H3,(H,23,25)/t17-,18-,19-/m0/s1 |
| InChIKey | DFHKSTVWCFTQJX-FHWLQOOXSA-N |
| XLogP | 3.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |