C23H28N2O3S — CID 86776075
1-(benzenesulfonyl)-N-(2-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 86776075) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(2-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 86776075 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2-phenylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CC2CCCCC2N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O3S/c26-23(24-16-15-18-9-3-1-4-10-18)22-17-19-11-7-8-14-21(19)25(22)29(27,28)20-12-5-2-6-13-20/h1-6,9-10,12-13,19,21-22H,7-8,11,14-17H2,(H,24,26) |
| InChIKey | DYWPTSLQAUZJER-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |