C23H36InN3O3 — CID 140508411
tert-butyl 4-[2-(2-phenylethylcarbamoyl)indiginan-1-yl]piperazine-1-carboxylate (PubChem CID 140508411) has the molecular formula C23H36InN3O3 and a molecular weight of 517.38 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-phenylethylcarbamoyl)indiginan-1-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-phenylethylcarbamoyl)indiginan-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140508411 |
| Molecular Formula | C23H36InN3O3 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | tert-butyl 4-[2-(2-phenylethylcarbamoyl)indiginan-1-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN([In]2CCCCC2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19NO.C9H17N2O2.In/c1-2-3-5-10-14(16)15-12-11-13-8-6-4-7-9-13;1-9(2,3)13-8(12)11-6-4-10-5-7-11;/h4,6-10H,1-3,5,11-12H2,(H,15,16);4-7H2,1-3H3;/q;-1;+1 |
| InChIKey | LUFMRNAAPRTRSC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |