C23H31N3O4S — CID 68760399
tert-butyl N-[5-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate (PubChem CID 68760399) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is tert-butyl N-[5-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate.
| Compound Name | tert-butyl N-[5-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 68760399 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | tert-butyl N-[5-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC2SCC(C(=O)NC3CCCc4ccccc43)N2C1=O |
| InChI | InChI=1S/C23H31N3O4S/c1-23(2,3)30-22(29)25-17-11-12-19-26(21(17)28)18(13-31-19)20(27)24-16-10-6-8-14-7-4-5-9-15(14)16/h4-5,7,9,16-19H,6,8,10-13H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | BUANSDXDSTZLOR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |