C25H36N4O5S — CID 146026924
formic acid;(4S)-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepine-7-carboxamide (PubChem CID 146026924) has the molecular formula C25H36N4O5S and a molecular weight of 504.65 g/mol. Its IUPAC name is formic acid;(4S)-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepine-7-carboxamide.
| Compound Name | formic acid;(4S)-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepine-7-carboxamide |
|---|---|
| PubChem CID | 146026924 |
| Molecular Formula | C25H36N4O5S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | formic acid;(4S)-4-[[(2S)-2-(methylamino)propanoyl]amino]-5-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3,4,7,8,9,10,10a-octahydropyrido[2,1-b][1,3]thiazepine-7-carboxamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H]1CCSC2CCCC(C(=O)N[C@@H]3CCCc4ccccc43)N2C1=O.O=CO |
| InChI | InChI=1S/C24H34N4O3S.CH2O2/c1-15(25-2)22(29)27-19-13-14-32-21-12-6-11-20(28(21)24(19)31)23(30)26-18-10-5-8-16-7-3-4-9-17(16)18;2-1-3/h3-4,7,9,15,18-21,25H,5-6,8,10-14H2,1-2H3,(H,26,30)(H,27,29);1H,(H,2,3)/t15-,18+,19-,20?,21?;/m0./s1 |
| InChIKey | ALQCYSRKFJQSJV-VBECRLKHSA-N |
| XLogP | 1.82 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|