C27H41N5O5 — CID 59415533
tert-butyl N-[[3,3-dimethyl-1-oxo-1-[(2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamoylamino]carbamate (PubChem CID 59415533) has the molecular formula C27H41N5O5 and a molecular weight of 515.66 g/mol. Its IUPAC name is tert-butyl N-[[3,3-dimethyl-1-oxo-1-[(2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamoylamino]carbamate.
| Compound Name | tert-butyl N-[[3,3-dimethyl-1-oxo-1-[(2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 59415533 |
| Molecular Formula | C27H41N5O5 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | tert-butyl N-[[3,3-dimethyl-1-oxo-1-[(2S)-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamoylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)NC(C(=O)N1CCC[C@H]1C(=O)N[C@@H]1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C27H41N5O5/c1-26(2,3)21(29-24(35)30-31-25(36)37-27(4,5)6)23(34)32-16-10-15-20(32)22(33)28-19-14-9-12-17-11-7-8-13-18(17)19/h7-8,11,13,19-21H,9-10,12,14-16H2,1-6H3,(H,28,33)(H,31,36)(H2,29,30,35)/t19-,20+,21?/m1/s1 |
| InChIKey | LRTNEBGZVCEFBD-PDYHCXRVSA-N |
| XLogP | 3.32 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|