C29H37N3O4 — CID 59415601
tert-butyl N-[(2S)-3-methyl-1-oxo-1-[1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-dihydroisoindol-2-yl]butan-2-yl]carbamate (PubChem CID 59415601) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-oxo-1-[1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-dihydroisoindol-2-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-dihydroisoindol-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59415601 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-dihydroisoindol-2-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1Cc2ccccc2C1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C29H37N3O4/c1-18(2)24(31-28(35)36-29(3,4)5)27(34)32-17-20-12-7-9-15-22(20)25(32)26(33)30-23-16-10-13-19-11-6-8-14-21(19)23/h6-9,11-12,14-15,18,23-25H,10,13,16-17H2,1-5H3,(H,30,33)(H,31,35)/t23-,24+,25?/m1/s1 |
| InChIKey | CXLLJTAMPHOOSQ-CSIQULDISA-N |
| XLogP | 4.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |