C23H34N4O4 — CID 11502879
(4S)-3-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-4-carboxamide (PubChem CID 11502879) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is (4S)-3-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-4-carboxamide.
| Compound Name | (4S)-3-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 11502879 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | (4S)-3-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-4-carboxamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1COC[C@H]1C(=O)N[C@@H]1CCCc2ccccc21)C(C)C |
| InChI | InChI=1S/C23H34N4O4/c1-14(2)20(26-21(28)15(3)24-4)23(30)27-13-31-12-19(27)22(29)25-18-11-7-9-16-8-5-6-10-17(16)18/h5-6,8,10,14-15,18-20,24H,7,9,11-13H2,1-4H3,(H,25,29)(H,26,28)/t15-,18+,19-,20-/m0/s1 |
| InChIKey | JCQPIAHVHVPZAD-LDTOTXGLSA-N |
| XLogP | 1.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |