C27H33N3O4S — CID 59415581
benzyl N-[(2S)-3-methyl-1-oxo-1-[(4R)-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-thiazolidin-3-yl]butan-2-yl]carbamate (PubChem CID 59415581) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-oxo-1-[(4R)-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-thiazolidin-3-yl]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[(4R)-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-thiazolidin-3-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59415581 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[(4R)-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-1,3-thiazolidin-3-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N1CSC[C@H]1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C27H33N3O4S/c1-18(2)24(29-27(33)34-15-19-9-4-3-5-10-19)26(32)30-17-35-16-23(30)25(31)28-22-14-8-12-20-11-6-7-13-21(20)22/h3-7,9-11,13,18,22-24H,8,12,14-17H2,1-2H3,(H,28,31)(H,29,33)/t22-,23+,24+/m1/s1 |
| InChIKey | GCFGMBYPPHWDOC-SGNDLWITSA-N |
| XLogP | 4.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |