C24H38N4O3 — CID 143537765
2-amino-N-[1-(2,4-dimethylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]acetamide;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide (PubChem CID 143537765) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-amino-N-[1-(2,4-dimethylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]acetamide;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide.
| Compound Name | 2-amino-N-[1-(2,4-dimethylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]acetamide;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
|---|---|
| PubChem CID | 143537765 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 2-amino-N-[1-(2,4-dimethylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl]acetamide;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
| SMILES | CC1CC(C)N(C(=O)C(NC(=O)CN)C(C)C)C1.O=CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C13H25N3O2.C11H13NO/c1-8(2)12(15-11(17)6-14)13(18)16-7-9(3)5-10(16)4;13-8-12-11-7-3-5-9-4-1-2-6-10(9)11/h8-10,12H,5-7,14H2,1-4H3,(H,15,17);1-2,4,6,8,11H,3,5,7H2,(H,12,13) |
| InChIKey | SDBWMBWSOHTELM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|