C30H51N5O6S — CID 143537833
tert-butyl N-[2-[[1-(4-amino-2-methylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate;sulfanol;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide (PubChem CID 143537833) has the molecular formula C30H51N5O6S and a molecular weight of 609.83 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(4-amino-2-methylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate;sulfanol;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide.
| Compound Name | tert-butyl N-[2-[[1-(4-amino-2-methylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate;sulfanol;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
|---|---|
| PubChem CID | 143537833 |
| Molecular Formula | C30H51N5O6S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | tert-butyl N-[2-[[1-(4-amino-2-methylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate;sulfanol;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
| SMILES | CC1CC(N)CN1C(=O)C(NC(=O)CN(C)C(=O)OC(C)(C)C)C(C)(C)C.O=CNC1CCCc2ccccc21.OS |
| InChI | InChI=1S/C19H36N4O4.C11H13NO.H2OS/c1-12-9-13(20)10-23(12)16(25)15(18(2,3)4)21-14(24)11-22(8)17(26)27-19(5,6)7;13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2/h12-13,15H,9-11,20H2,1-8H3,(H,21,24);1-2,4,6,8,11H,3,5,7H2,(H,12,13);1-2H |
| InChIKey | PMAQZFWKMYRDFT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|