C26H41N5O3 — CID 70988087
(2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(dimethylamino)propanoyl]amino]-3,3-dimethylbutanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 70988087) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(dimethylamino)propanoyl]amino]-3,3-dimethylbutanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(dimethylamino)propanoyl]amino]-3,3-dimethylbutanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70988087 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(dimethylamino)propanoyl]amino]-3,3-dimethylbutanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H](C(=O)N[C@H](C(=O)N1C[C@@H](N)C[C@H]1C(=O)N[C@@H]1CCCc2ccccc21)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C26H41N5O3/c1-16(30(5)6)23(32)29-22(26(2,3)4)25(34)31-15-18(27)14-21(31)24(33)28-20-13-9-11-17-10-7-8-12-19(17)20/h7-8,10,12,16,18,20-22H,9,11,13-15,27H2,1-6H3,(H,28,33)(H,29,32)/t16-,18-,20+,21-,22+/m0/s1 |
| InChIKey | MWIQJYBQTLZTIN-OAVQTBGQSA-N |
| XLogP | 1.59 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |