C25H39N5O3 — CID 126692693
1-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-4-(methylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide (PubChem CID 126692693) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-4-(methylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-4-(methylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126692693 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 1-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-4-(methylamino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CNCC(=O)NC(C(=O)N1CC(NC)CC1C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C25H39N5O3/c1-25(2,3)22(29-21(31)14-26-4)24(33)30-15-17(27-5)13-20(30)23(32)28-19-12-8-10-16-9-6-7-11-18(16)19/h6-7,9,11,17,19-20,22,26-27H,8,10,12-15H2,1-5H3,(H,28,32)(H,29,31) |
| InChIKey | RZTJFDXJUHBWEY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |