C35H62N6O4 — CID 145496741
tert-butyl N-[(Z,2S)-3-[[1-(4-amino-2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]hex-3-en-2-yl]-N-methylcarbamate;methanamine;N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 145496741) has the molecular formula C35H62N6O4 and a molecular weight of 630.92 g/mol. Its IUPAC name is tert-butyl N-[(Z,2S)-3-[[1-(4-amino-2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]hex-3-en-2-yl]-N-methylcarbamate;methanamine;N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | tert-butyl N-[(Z,2S)-3-[[1-(4-amino-2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]hex-3-en-2-yl]-N-methylcarbamate;methanamine;N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 145496741 |
| Molecular Formula | C35H62N6O4 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.48 |
| IUPAC Name | tert-butyl N-[(Z,2S)-3-[[1-(4-amino-2-formylpyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]amino]hex-3-en-2-yl]-N-methylcarbamate;methanamine;N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC/C=C(\NC(C(=O)N1CC(N)CC1C=O)C(C)(C)C)[C@H](C)N(C)C(=O)OC(C)(C)C.CN.CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C23H42N4O4.C11H15N.CH5N/c1-10-11-18(15(2)26(9)21(30)31-23(6,7)8)25-19(22(3,4)5)20(29)27-13-16(24)12-17(27)14-28;1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2/h11,14-17,19,25H,10,12-13,24H2,1-9H3;2-3,5,7,11-12H,4,6,8H2,1H3;2H2,1H3/b18-11-;;/t15-,16?,17?,19?;;/m0../s1 |
| InChIKey | XWDXNMUTYDMCIW-XIZSWNGUSA-N |
| XLogP | 4.53 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|