C21H33N3O3 — CID 145496732
tert-butyl 4-amino-2-methylpyrrolidine-1-carboxylate;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide (PubChem CID 145496732) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 4-amino-2-methylpyrrolidine-1-carboxylate;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide.
| Compound Name | tert-butyl 4-amino-2-methylpyrrolidine-1-carboxylate;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
|---|---|
| PubChem CID | 145496732 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl 4-amino-2-methylpyrrolidine-1-carboxylate;N-(1,2,3,4-tetrahydronaphthalen-1-yl)formamide |
| SMILES | CC1CC(N)CN1C(=O)OC(C)(C)C.O=CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H13NO.C10H20N2O2/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-7-5-8(11)6-12(7)9(13)14-10(2,3)4/h1-2,4,6,8,11H,3,5,7H2,(H,12,13);7-8H,5-6,11H2,1-4H3 |
| InChIKey | ZUEZOPJMYMDFME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|