C15H23N3O4S — CID 134106785
tert-butyl N-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoylamino)carbamate (PubChem CID 134106785) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl N-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoylamino)carbamate.
| Compound Name | tert-butyl N-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoylamino)carbamate |
|---|---|
| PubChem CID | 134106785 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl N-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H23N3O4S/c1-15(2,3)22-14(19)16-18-23(20,21)17-13-10-6-8-11-7-4-5-9-12(11)13/h4-5,7,9,13,17-18H,6,8,10H2,1-3H3,(H,16,19) |
| InChIKey | FHJDDQLSHZXXJV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|