C33H41F2NO5 — CID 144527954
1-O-tert-butyl 2-O-[2-(9,9-difluoro-7-propan-2-ylfluoren-2-yl)-2-oxoethyl] 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate;ethane (PubChem CID 144527954) has the molecular formula C33H41F2NO5 and a molecular weight of 569.69 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-(9,9-difluoro-7-propan-2-ylfluoren-2-yl)-2-oxoethyl] 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate;ethane.
| Compound Name | 1-O-tert-butyl 2-O-[2-(9,9-difluoro-7-propan-2-ylfluoren-2-yl)-2-oxoethyl] 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate;ethane |
|---|---|
| PubChem CID | 144527954 |
| Molecular Formula | C33H41F2NO5 |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-(9,9-difluoro-7-propan-2-ylfluoren-2-yl)-2-oxoethyl] 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1,2-dicarboxylate;ethane |
| SMILES | CC.CC(C)c1ccc2c(c1)C(F)(F)c1cc(C(=O)COC(=O)C3CC4CCCC4N3C(=O)OC(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C31H35F2NO5.C2H6/c1-17(2)18-9-11-21-22-12-10-20(14-24(22)31(32,33)23(21)13-18)27(35)16-38-28(36)26-15-19-7-6-8-25(19)34(26)29(37)39-30(3,4)5;1-2/h9-14,17,19,25-26H,6-8,15-16H2,1-5H3;1-2H3 |
| InChIKey | QXAUUNUYIBDJBD-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |