C20H29NO3 — CID 15811672
tert-butyl (2R,3aR,6aR)-2-[(S)-hydroxy-(4-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 15811672) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl (2R,3aR,6aR)-2-[(S)-hydroxy-(4-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R,3aR,6aR)-2-[(S)-hydroxy-(4-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15811672 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl (2R,3aR,6aR)-2-[(S)-hydroxy-(4-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | Cc1ccc([C@H](O)[C@H]2C[C@H]3CCC[C@H]3N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-13-8-10-14(11-9-13)18(22)17-12-15-6-5-7-16(15)21(17)19(23)24-20(2,3)4/h8-11,15-18,22H,5-7,12H2,1-4H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | JHRXLIDAGVLWKX-TVFCKZIOSA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |