C21H31NO3 — CID 15329541
tert-butyl (2S,3aR,6aR)-2-[(R)-(2,5-dimethylphenyl)-hydroxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 15329541) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl (2S,3aR,6aR)-2-[(R)-(2,5-dimethylphenyl)-hydroxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aR,6aR)-2-[(R)-(2,5-dimethylphenyl)-hydroxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15329541 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl (2S,3aR,6aR)-2-[(R)-(2,5-dimethylphenyl)-hydroxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | Cc1ccc(C)c([C@@H](O)[C@@H]2C[C@H]3CCC[C@H]3N2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H31NO3/c1-13-9-10-14(2)16(11-13)19(23)18-12-15-7-6-8-17(15)22(18)20(24)25-21(3,4)5/h9-11,15,17-19,23H,6-8,12H2,1-5H3/t15-,17-,18+,19-/m1/s1 |
| InChIKey | JSYQEDKIKMYWCE-OQIJWPOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |