C24H29N3O2 — CID 122450852
tert-butyl (2S,3aS,6aS)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 122450852) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is tert-butyl (2S,3aS,6aS)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,6aS)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 122450852 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | tert-butyl (2S,3aS,6aS)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | Cc1ccc2c(ccc3[nH]c([C@@H]4C[C@@H]5CCC[C@@H]5N4C(=O)OC(C)(C)C)nc32)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-14-8-10-17-15(12-14)9-11-18-21(17)26-22(25-18)20-13-16-6-5-7-19(16)27(20)23(28)29-24(2,3)4/h8-12,16,19-20H,5-7,13H2,1-4H3,(H,25,26)/t16-,19-,20-/m0/s1 |
| InChIKey | HXTVANOEBAEZKS-VDGAXYAQSA-N |
| XLogP | 5.88 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |