C26H33N3O2Si — CID 58384738
tert-butyl (2S,4S)-4-methyl-2-[7-(2-trimethylsilylethynyl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58384738) has the molecular formula C26H33N3O2Si and a molecular weight of 447.66 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-methyl-2-[7-(2-trimethylsilylethynyl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-methyl-2-[7-(2-trimethylsilylethynyl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58384738 |
| Molecular Formula | C26H33N3O2Si |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | tert-butyl (2S,4S)-4-methyl-2-[7-(2-trimethylsilylethynyl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](c2nc3c(ccc4cc(C#C[Si](C)(C)C)ccc43)[nH]2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H33N3O2Si/c1-17-14-22(29(16-17)25(30)31-26(2,3)4)24-27-21-11-9-19-15-18(12-13-32(5,6)7)8-10-20(19)23(21)28-24/h8-11,15,17,22H,14,16H2,1-7H3,(H,27,28)/t17-,22-/m0/s1 |
| InChIKey | KBZCBBOFMLRHOY-JTSKRJEESA-N |
| XLogP | 6.26 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|