C23H27N3O3 — CID 122450861
tert-butyl (2S,3aS,6aR)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate (PubChem CID 122450861) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl (2S,3aS,6aR)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,6aR)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 122450861 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl (2S,3aS,6aR)-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate |
| SMILES | Cc1ccc2c(ccc3[nH]c([C@@H]4C[C@@H]5COC[C@@H]5N4C(=O)OC(C)(C)C)nc32)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-13-5-7-16-14(9-13)6-8-17-20(16)25-21(24-17)18-10-15-11-28-12-19(15)26(18)22(27)29-23(2,3)4/h5-9,15,18-19H,10-12H2,1-4H3,(H,24,25)/t15-,18+,19+/m1/s1 |
| InChIKey | PNZMJVAMVXCDOQ-MNEFBYGVSA-N |
| XLogP | 4.72 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |