C23H33NO5 — CID 144534783
tert-butyl (2S)-2-formyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate;2-methoxy-1-(3-methylphenyl)ethanone (PubChem CID 144534783) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-formyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate;2-methoxy-1-(3-methylphenyl)ethanone.
| Compound Name | tert-butyl (2S)-2-formyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate;2-methoxy-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 144534783 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | tert-butyl (2S)-2-formyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate;2-methoxy-1-(3-methylphenyl)ethanone |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC2C[C@H]1C=O.COCC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C13H21NO3.C10H12O2/c1-13(2,3)17-12(16)14-10(8-15)7-9-5-4-6-11(9)14;1-8-4-3-5-9(6-8)10(11)7-12-2/h8-11H,4-7H2,1-3H3;3-6H,7H2,1-2H3/t9?,10-,11?;/m0./s1 |
| InChIKey | DKPFNYBZWWOCHI-FNLIVBFMSA-N |
| XLogP | 4.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|