C15H20N6 — CID 112952675
5-(azepan-1-yl)-N-(pyridin-4-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 112952675) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 5-(azepan-1-yl)-N-(pyridin-4-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(azepan-1-yl)-N-(pyridin-4-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112952675 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 5-(azepan-1-yl)-N-(pyridin-4-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | c1cc(CNc2nncc(N3CCCCCC3)n2)ccn1 |
| InChI | InChI=1S/C15H20N6/c1-2-4-10-21(9-3-1)14-12-18-20-15(19-14)17-11-13-5-7-16-8-6-13/h5-8,12H,1-4,9-11H2,(H,17,19,20) |
| InChIKey | MHWLNCSSDXXSMG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |