C10H15N5 — CID 112939679
N-prop-2-enyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 112939679) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-prop-2-enyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-prop-2-enyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112939679 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-prop-2-enyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | C=CCNc1nncc(N2CCCC2)n1 |
| InChI | InChI=1S/C10H15N5/c1-2-5-11-10-13-9(8-12-14-10)15-6-3-4-7-15/h2,8H,1,3-7H2,(H,11,13,14) |
| InChIKey | XGCXKTISXYIUNZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|