C11H16N6O — CID 112939694
4-[3-(prop-2-enylamino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde (PubChem CID 112939694) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[3-(prop-2-enylamino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(prop-2-enylamino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112939694 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[3-(prop-2-enylamino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
| SMILES | C=CCNc1nncc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C11H16N6O/c1-2-3-12-11-14-10(8-13-15-11)17-6-4-16(9-18)5-7-17/h2,8-9H,1,3-7H2,(H,12,14,15) |
| InChIKey | SPEIBZALDBUECS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|