C12H17N5O — CID 112854888
4-[6-(prop-2-enylamino)pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112854888) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-[6-(prop-2-enylamino)pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-(prop-2-enylamino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112854888 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-[6-(prop-2-enylamino)pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | C=CCNc1cc(N2CCN(C=O)CC2)ncn1 |
| InChI | InChI=1S/C12H17N5O/c1-2-3-13-11-8-12(15-9-14-11)17-6-4-16(10-18)5-7-17/h2,8-10H,1,3-7H2,(H,13,14,15) |
| InChIKey | BDGDDSSRLUZWND-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|