C19H24N6 — CID 112939742
5-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-prop-2-enyl-1,2,4-triazin-3-amine (PubChem CID 112939742) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-prop-2-enyl-1,2,4-triazin-3-amine.
| Compound Name | 5-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-prop-2-enyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112939742 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-prop-2-enyl-1,2,4-triazin-3-amine |
| SMILES | C=CCNc1nncc(N2CCN(C/C=C/c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H24N6/c1-2-10-20-19-22-18(16-21-23-19)25-14-12-24(13-15-25)11-6-9-17-7-4-3-5-8-17/h2-9,16H,1,10-15H2,(H,20,22,23)/b9-6+ |
| InChIKey | NXFQKCPDKRDYPI-RMKNXTFCSA-N |
| XLogP | 2.30 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|