C20H18N6 — CID 112953065
3-N-(2-phenylethyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine (PubChem CID 112953065) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is 3-N-(2-phenylethyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-phenylethyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112953065 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-N-(2-phenylethyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc(CCNc2nncc(Nc3cccc4cccnc34)n2)cc1 |
| InChI | InChI=1S/C20H18N6/c1-2-6-15(7-3-1)11-13-22-20-25-18(14-23-26-20)24-17-10-4-8-16-9-5-12-21-19(16)17/h1-10,12,14H,11,13H2,(H2,22,24,25,26) |
| InChIKey | RYENPHXAWQKJDQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |