C33H42N2O4 — CID 11295506
(1R,7S)-4-[4-[[4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 11295506) has the molecular formula C33H42N2O4 and a molecular weight of 530.71 g/mol. Its IUPAC name is (1R,7S)-4-[4-[[4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,7S)-4-[4-[[4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 11295506 |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (1R,7S)-4-[4-[[4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1CC(CC2CCC(N3C(=O)C4C(C3=O)[C@H]3C=C[C@@H]4C3)C(C)C2)CCC1N1C(=O)C2C(C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C33H42N2O4/c1-16-11-18(3-9-24(16)34-30(36)26-20-5-6-21(14-20)27(26)31(34)37)13-19-4-10-25(17(2)12-19)35-32(38)28-22-7-8-23(15-22)29(28)33(35)39/h5-8,16-29H,3-4,9-15H2,1-2H3/t16?,17?,18?,19?,20-,21+,22-,23+,24?,25?,26?,27?,28?,29? |
| InChIKey | ZOLVAJOEBQQKPL-GGFPVGRJSA-N |
| XLogP | 4.60 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|