C23H25N7 — CID 112955901
3-N-[2-(1H-indol-3-yl)ethyl]-5-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112955901) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-N-[2-(1H-indol-3-yl)ethyl]-5-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[2-(1H-indol-3-yl)ethyl]-5-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955901 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-N-[2-(1H-indol-3-yl)ethyl]-5-N-(4-pyrrolidin-1-ylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc2c(CCNc3nncc(Nc4ccc(N5CCCC5)cc4)n3)c[nH]c2c1 |
| InChI | InChI=1S/C23H25N7/c1-2-6-21-20(5-1)17(15-25-21)11-12-24-23-28-22(16-26-29-23)27-18-7-9-19(10-8-18)30-13-3-4-14-30/h1-2,5-10,15-16,25H,3-4,11-14H2,(H2,24,27,28,29) |
| InChIKey | WMVUXTLLIIJBEQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|