C22H24N6 — CID 112955734
5-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112955734) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 5-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955734 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 5-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-phenylpropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc(CCCNc2nncc(NCCc3c[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C22H24N6/c1-2-7-17(8-3-1)9-6-13-24-22-27-21(16-26-28-22)23-14-12-18-15-25-20-11-5-4-10-19(18)20/h1-5,7-8,10-11,15-16,25H,6,9,12-14H2,(H2,23,24,27,28) |
| InChIKey | GVEIRMIYZKJYQX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|