C26H26F4NO3PS — CID 11295642
[(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium;trifluoromethanesulfonate (PubChem CID 11295642) has the molecular formula C26H26F4NO3PS and a molecular weight of 539.53 g/mol. Its IUPAC name is [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium;trifluoromethanesulfonate.
| Compound Name | [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11295642 |
| Molecular Formula | C26H26F4NO3PS |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium;trifluoromethanesulfonate |
| SMILES | F/C(=C\[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1CCCCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H26FNP.CHF3O3S/c26-25(27-19-11-4-12-20-27)21-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)24-17-9-3-10-18-24;2-1(3,4)8(5,6)7/h1-3,5-10,13-18,21H,4,11-12,19-20H2;(H,5,6,7)/q+1;/p-1/b25-21+; |
| InChIKey | VNFFVZITJFPLAP-JMFMGIQESA-M |
| XLogP | 5.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|