C38H39N3O2 — CID 11296045
(4S)-4-tert-butyl-2-[8-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3,6-diphenyl-9H-carbazol-1-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 11296045) has the molecular formula C38H39N3O2 and a molecular weight of 569.75 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-[8-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3,6-diphenyl-9H-carbazol-1-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-tert-butyl-2-[8-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3,6-diphenyl-9H-carbazol-1-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11296045 |
| Molecular Formula | C38H39N3O2 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | (4S)-4-tert-butyl-2-[8-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3,6-diphenyl-9H-carbazol-1-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)[C@H]1COC(c2cc(-c3ccccc3)cc3c2[nH]c2c(C4=N[C@@H](C(C)(C)C)CO4)cc(-c4ccccc4)cc23)=N1 |
| InChI | InChI=1S/C38H39N3O2/c1-37(2,3)31-21-42-35(39-31)29-19-25(23-13-9-7-10-14-23)17-27-28-18-26(24-15-11-8-12-16-24)20-30(34(28)41-33(27)29)36-40-32(22-43-36)38(4,5)6/h7-20,31-32,41H,21-22H2,1-6H3/t31-,32-/m1/s1 |
| InChIKey | IIPQMCWOSWHUIW-ROJLCIKYSA-N |
| XLogP | 9.04 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |