C33H40N2O8S — CID 11296564
tert-butyl (2S,6S)-6-[2-(benzenesulfonyloxy)ethyl]-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]-3-oxopiperazine-1-carboxylate (PubChem CID 11296564) has the molecular formula C33H40N2O8S and a molecular weight of 624.76 g/mol. Its IUPAC name is tert-butyl (2S,6S)-6-[2-(benzenesulfonyloxy)ethyl]-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6S)-6-[2-(benzenesulfonyloxy)ethyl]-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 11296564 |
| Molecular Formula | C33H40N2O8S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | tert-butyl (2S,6S)-6-[2-(benzenesulfonyloxy)ethyl]-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]-3-oxopiperazine-1-carboxylate |
| SMILES | COc1ccc(CN2C[C@H](CCOS(=O)(=O)c3ccccc3)N(C(=O)OC(C)(C)C)[C@@H](Cc3ccccc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C33H40N2O8S/c1-33(2,3)43-32(37)35-26(18-19-42-44(38,39)28-14-10-7-11-15-28)23-34(22-25-16-17-27(40-4)21-30(25)41-5)31(36)29(35)20-24-12-8-6-9-13-24/h6-17,21,26,29H,18-20,22-23H2,1-5H3/t26-,29-/m0/s1 |
| InChIKey | JMQLONOBCRZNQQ-WNJJXGMVSA-N |
| XLogP | 5.06 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|