C19H16N6O — CID 112967432
3-N-(4-methoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine (PubChem CID 112967432) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-N-(4-methoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(4-methoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112967432 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-N-(4-methoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Nc2nncc(Nc3cccc4cccnc34)n2)cc1 |
| InChI | InChI=1S/C19H16N6O/c1-26-15-9-7-14(8-10-15)22-19-24-17(12-21-25-19)23-16-6-2-4-13-5-3-11-20-18(13)16/h2-12H,1H3,(H2,22,23,24,25) |
| InChIKey | OIYHPNRIOXZNKH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |