C20H18N6O2 — CID 112968061
3-N-(2,4-dimethoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine (PubChem CID 112968061) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-N-(2,4-dimethoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,4-dimethoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112968061 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-N-(2,4-dimethoxyphenyl)-5-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Nc2nncc(Nc3cccc4cccnc34)n2)c(OC)c1 |
| InChI | InChI=1S/C20H18N6O2/c1-27-14-8-9-15(17(11-14)28-2)24-20-25-18(12-22-26-20)23-16-7-3-5-13-6-4-10-21-19(13)16/h3-12H,1-2H3,(H2,23,24,25,26) |
| InChIKey | ASCBPXMRZWOURZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |