C18H13FN6 — CID 112969076
5-N-(3-fluorophenyl)-3-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine (PubChem CID 112969076) has the molecular formula C18H13FN6 and a molecular weight of 332.34 g/mol. Its IUPAC name is 5-N-(3-fluorophenyl)-3-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3-fluorophenyl)-3-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112969076 |
| Molecular Formula | C18H13FN6 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-N-(3-fluorophenyl)-3-N-quinolin-8-yl-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1cccc(Nc2cnnc(Nc3cccc4cccnc34)n2)c1 |
| InChI | InChI=1S/C18H13FN6/c19-13-6-2-7-14(10-13)22-16-11-21-25-18(24-16)23-15-8-1-4-12-5-3-9-20-17(12)15/h1-11H,(H2,22,23,24,25) |
| InChIKey | NVLVDIZWAYRGAT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |