C17H13Cl2N5O2 — CID 112969315
5-N-(2,5-dichlorophenyl)-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazine-3,5-diamine (PubChem CID 112969315) has the molecular formula C17H13Cl2N5O2 and a molecular weight of 390.23 g/mol. Its IUPAC name is 5-N-(2,5-dichlorophenyl)-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,5-dichlorophenyl)-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112969315 |
| Molecular Formula | C17H13Cl2N5O2 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-N-(2,5-dichlorophenyl)-3-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazine-3,5-diamine |
| SMILES | Clc1ccc(Cl)c(Nc2cnnc(Nc3ccc4c(c3)OCCO4)n2)c1 |
| InChI | InChI=1S/C17H13Cl2N5O2/c18-10-1-3-12(19)13(7-10)22-16-9-20-24-17(23-16)21-11-2-4-14-15(8-11)26-6-5-25-14/h1-4,7-9H,5-6H2,(H2,21,22,23,24) |
| InChIKey | JTGAOQDAXJESIW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |