C20H21N3O2 — CID 112975099
1-(2-cyanophenyl)-3-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]urea (PubChem CID 112975099) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]urea.
| Compound Name | 1-(2-cyanophenyl)-3-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]urea |
|---|---|
| PubChem CID | 112975099 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(2-cyanophenyl)-3-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethyl]urea |
| SMILES | N#Cc1ccccc1NC(=O)NCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C20H21N3O2/c21-14-16-7-2-4-10-18(16)23-20(24)22-12-13-25-19-11-5-8-15-6-1-3-9-17(15)19/h2,4-5,7-8,10-11H,1,3,6,9,12-13H2,(H2,22,23,24) |
| InChIKey | GGLCBYOVZIRZGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|