C13H18ClFN2O2 — CID 112977021
3-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,1-diethylurea (PubChem CID 112977021) has the molecular formula C13H18ClFN2O2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 3-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,1-diethylurea.
| Compound Name | 3-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 112977021 |
| Molecular Formula | C13H18ClFN2O2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCCOc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H18ClFN2O2/c1-3-17(4-2)13(18)16-7-8-19-12-6-5-10(15)9-11(12)14/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | PYRDPBBZJHHYKT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|