C18H27ClN2O2 — CID 112977193
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide (PubChem CID 112977193) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 112977193 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-ethylpiperidine-1-carboxamide |
| SMILES | CCC1CCCCN1C(=O)NCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C18H27ClN2O2/c1-4-15-7-5-6-9-21(15)18(22)20-8-10-23-16-11-13(2)17(19)14(3)12-16/h11-12,15H,4-10H2,1-3H3,(H,20,22) |
| InChIKey | GGANUUPJJACEDH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|